C25H27FN2O3 — CID 97497096
N-[(1R)-6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-yl]-4-(4-methoxyphenyl)oxane-4-carboxamide (PubChem CID 97497096) has the molecular formula C25H27FN2O3 and a molecular weight of 422.50 g/mol. Its IUPAC name is N-[(1R)-6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-yl]-4-(4-methoxyphenyl)oxane-4-carboxamide.
| Compound Name | N-[(1R)-6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-yl]-4-(4-methoxyphenyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 97497096 |
| Molecular Formula | C25H27FN2O3 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | N-[(1R)-6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-yl]-4-(4-methoxyphenyl)oxane-4-carboxamide |
| SMILES | COc1ccc(C2(C(=O)N[C@@H]3CCCc4c3[nH]c3ccc(F)cc43)CCOCC2)cc1 |
| InChI | InChI=1S/C25H27FN2O3/c1-30-18-8-5-16(6-9-18)25(11-13-31-14-12-25)24(29)28-22-4-2-3-19-20-15-17(26)7-10-21(20)27-23(19)22/h5-10,15,22,27H,2-4,11-14H2,1H3,(H,28,29)/t22-/m1/s1 |
| InChIKey | BUHVTJAAWFCPGP-JOCHJYFZSA-N |
| XLogP | 4.56 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|