C21H26N2 — CID 2840334
6-cyclohexyl-N-prop-2-enyl-2,3,4,9-tetrahydrocarbazol-1-imine (PubChem CID 2840334) has the molecular formula C21H26N2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 6-cyclohexyl-N-prop-2-enyl-2,3,4,9-tetrahydrocarbazol-1-imine.
| Compound Name | 6-cyclohexyl-N-prop-2-enyl-2,3,4,9-tetrahydrocarbazol-1-imine |
|---|---|
| PubChem CID | 2840334 |
| Molecular Formula | C21H26N2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 6-cyclohexyl-N-prop-2-enyl-2,3,4,9-tetrahydrocarbazol-1-imine |
| SMILES | C=CC/N=C1\CCCc2c1[nH]c1ccc(C3CCCCC3)cc21 |
| InChI | InChI=1S/C21H26N2/c1-2-13-22-20-10-6-9-17-18-14-16(15-7-4-3-5-8-15)11-12-19(18)23-21(17)20/h2,11-12,14-15,23H,1,3-10,13H2/b22-20+ |
| InChIKey | NTNNELMKIOBKSW-LSDHQDQOSA-N |
| XLogP | 5.53 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|