C21H20N6O — CID 26122569
N-[3-(1-methyltetrazol-5-yl)phenyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 26122569) has the molecular formula C21H20N6O and a molecular weight of 372.43 g/mol. Its IUPAC name is N-[3-(1-methyltetrazol-5-yl)phenyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | N-[3-(1-methyltetrazol-5-yl)phenyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 26122569 |
| Molecular Formula | C21H20N6O |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | N-[3-(1-methyltetrazol-5-yl)phenyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | Cn1nnnc1-c1cccc(NC(=O)c2ccc3[nH]c4c(c3c2)CCCC4)c1 |
| InChI | InChI=1S/C21H20N6O/c1-27-20(24-25-26-27)13-5-4-6-15(11-13)22-21(28)14-9-10-19-17(12-14)16-7-2-3-8-18(16)23-19/h4-6,9-12,23H,2-3,7-8H2,1H3,(H,22,28) |
| InChIKey | VFIFXAUKITXZOX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|