C26H31N3O3S — CID 26919628
(6R)-N-[3-(azepan-1-ylsulfonyl)phenyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 26919628) has the molecular formula C26H31N3O3S and a molecular weight of 465.62 g/mol. Its IUPAC name is (6R)-N-[3-(azepan-1-ylsulfonyl)phenyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | (6R)-N-[3-(azepan-1-ylsulfonyl)phenyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 26919628 |
| Molecular Formula | C26H31N3O3S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | (6R)-N-[3-(azepan-1-ylsulfonyl)phenyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | C[C@@H]1CCc2[nH]c3ccc(C(=O)Nc4cccc(S(=O)(=O)N5CCCCCC5)c4)cc3c2C1 |
| InChI | InChI=1S/C26H31N3O3S/c1-18-9-11-24-22(15-18)23-16-19(10-12-25(23)28-24)26(30)27-20-7-6-8-21(17-20)33(31,32)29-13-4-2-3-5-14-29/h6-8,10,12,16-18,28H,2-5,9,11,13-15H2,1H3,(H,27,30)/t18-/m1/s1 |
| InChIKey | WVOHKVPCDHUZSX-GOSISDBHSA-N |
| XLogP | 5.11 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|