C27H28FN3O2 — CID 11996356
2-[(3R)-6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl]-N-[[(2S)-8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl]methyl]ethanamine (PubChem CID 11996356) has the molecular formula C27H28FN3O2 and a molecular weight of 445.54 g/mol. Its IUPAC name is 2-[(3R)-6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl]-N-[[(2S)-8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl]methyl]ethanamine.
| Compound Name | 2-[(3R)-6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl]-N-[[(2S)-8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 11996356 |
| Molecular Formula | C27H28FN3O2 |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 2-[(3R)-6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl]-N-[[(2S)-8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl]methyl]ethanamine |
| SMILES | Cc1ccc2c3c(ccc2n1)OC[C@H](CNCC[C@@H]1CCc2[nH]c4ccc(F)cc4c2C1)O3 |
| InChI | InChI=1S/C27H28FN3O2/c1-16-2-5-20-23(30-16)8-9-26-27(20)33-19(15-32-26)14-29-11-10-17-3-6-24-21(12-17)22-13-18(28)4-7-25(22)31-24/h2,4-5,7-9,13,17,19,29,31H,3,6,10-12,14-15H2,1H3/t17-,19-/m0/s1 |
| InChIKey | MSWLDLDVYADSGW-HKUYNNGSSA-N |
| XLogP | 5.09 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|