C24H24FN3O3 — CID 75116646
3-[[(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)methylamino]methyl]-2,3,7,9-tetrahydro-[1,4]dioxino[2,3-e]indol-8-one (PubChem CID 75116646) has the molecular formula C24H24FN3O3 and a molecular weight of 421.47 g/mol. Its IUPAC name is 3-[[(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)methylamino]methyl]-2,3,7,9-tetrahydro-[1,4]dioxino[2,3-e]indol-8-one.
| Compound Name | 3-[[(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)methylamino]methyl]-2,3,7,9-tetrahydro-[1,4]dioxino[2,3-e]indol-8-one |
|---|---|
| PubChem CID | 75116646 |
| Molecular Formula | C24H24FN3O3 |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 3-[[(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)methylamino]methyl]-2,3,7,9-tetrahydro-[1,4]dioxino[2,3-e]indol-8-one |
| SMILES | O=C1Cc2c(ccc3c2OCC(CNCC2CCc4[nH]c5ccc(F)cc5c4C2)O3)N1 |
| InChI | InChI=1S/C24H24FN3O3/c25-14-2-4-20-17(8-14)16-7-13(1-3-19(16)27-20)10-26-11-15-12-30-24-18-9-23(29)28-21(18)5-6-22(24)31-15/h2,4-6,8,13,15,26-27H,1,3,7,9-12H2,(H,28,29) |
| InChIKey | SDLSVMUKJMMARH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|