C28H31N3O4 — CID 75227731
3-[[3-[(2-oxo-3,4-dihydro-1H-quinolin-7-yl)methyl]-8-azabicyclo[3.2.1]octan-8-yl]methyl]-2,3,7,9-tetrahydro-[1,4]dioxino[2,3-e]indol-8-one (PubChem CID 75227731) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is 3-[[3-[(2-oxo-3,4-dihydro-1H-quinolin-7-yl)methyl]-8-azabicyclo[3.2.1]octan-8-yl]methyl]-2,3,7,9-tetrahydro-[1,4]dioxino[2,3-e]indol-8-one.
| Compound Name | 3-[[3-[(2-oxo-3,4-dihydro-1H-quinolin-7-yl)methyl]-8-azabicyclo[3.2.1]octan-8-yl]methyl]-2,3,7,9-tetrahydro-[1,4]dioxino[2,3-e]indol-8-one |
|---|---|
| PubChem CID | 75227731 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 3-[[3-[(2-oxo-3,4-dihydro-1H-quinolin-7-yl)methyl]-8-azabicyclo[3.2.1]octan-8-yl]methyl]-2,3,7,9-tetrahydro-[1,4]dioxino[2,3-e]indol-8-one |
| SMILES | O=C1CCc2ccc(CC3CC4CCC(C3)N4CC3COc4c(ccc5c4CC(=O)N5)O3)cc2N1 |
| InChI | InChI=1S/C28H31N3O4/c32-26-8-3-18-2-1-16(12-24(18)30-26)9-17-10-19-4-5-20(11-17)31(19)14-21-15-34-28-22-13-27(33)29-23(22)6-7-25(28)35-21/h1-2,6-7,12,17,19-21H,3-5,8-11,13-15H2,(H,29,33)(H,30,32) |
| InChIKey | DZVJBZTUTCHLSB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |