C27H28Cl2N4O2 — CID 69235799
(6S)-6-[[[(2S)-8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl]methylamino]methyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carbonitrile;dihydrochloride (PubChem CID 69235799) has the molecular formula C27H28Cl2N4O2 and a molecular weight of 511.45 g/mol. Its IUPAC name is (6S)-6-[[[(2S)-8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl]methylamino]methyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carbonitrile;dihydrochloride.
| Compound Name | (6S)-6-[[[(2S)-8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl]methylamino]methyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carbonitrile;dihydrochloride |
|---|---|
| PubChem CID | 69235799 |
| Molecular Formula | C27H28Cl2N4O2 |
| Molecular Weight | 511.45 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | (6S)-6-[[[(2S)-8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl]methylamino]methyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carbonitrile;dihydrochloride |
| SMILES | Cc1ccc2c3c(ccc2n1)OC[C@H](CNC[C@H]1CCc2[nH]c4ccc(C#N)cc4c2C1)O3.Cl.Cl |
| InChI | InChI=1S/C27H26N4O2.2ClH/c1-16-2-5-20-23(30-16)8-9-26-27(20)33-19(15-32-26)14-29-13-18-4-7-25-22(11-18)21-10-17(12-28)3-6-24(21)31-25;;/h2-3,5-6,8-10,18-19,29,31H,4,7,11,13-15H2,1H3;2*1H/t18-,19-;;/m0../s1 |
| InChIKey | LTRCDIMSQLPYGV-JYRWABTFSA-N |
| XLogP | 5.27 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.45 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|