C27H29N3O3 — CID 69232650
1-[(3S)-8-methoxy-2,3,4,9-tetrahydro-1H-carbazol-3-yl]-N-[[(2S)-8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl]methyl]methanamine (PubChem CID 69232650) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is 1-[(3S)-8-methoxy-2,3,4,9-tetrahydro-1H-carbazol-3-yl]-N-[[(2S)-8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl]methyl]methanamine.
| Compound Name | 1-[(3S)-8-methoxy-2,3,4,9-tetrahydro-1H-carbazol-3-yl]-N-[[(2S)-8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl]methyl]methanamine |
|---|---|
| PubChem CID | 69232650 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 1-[(3S)-8-methoxy-2,3,4,9-tetrahydro-1H-carbazol-3-yl]-N-[[(2S)-8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl]methyl]methanamine |
| SMILES | COc1cccc2c3c([nH]c12)CC[C@H](CNC[C@H]1COc2ccc4nc(C)ccc4c2O1)C3 |
| InChI | InChI=1S/C27H29N3O3/c1-16-6-8-20-22(29-16)10-11-25-27(20)33-18(15-32-25)14-28-13-17-7-9-23-21(12-17)19-4-3-5-24(31-2)26(19)30-23/h3-6,8,10-11,17-18,28,30H,7,9,12-15H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | KFRIKFKFLGCYEP-ROUUACIJSA-N |
| XLogP | 4.57 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|