C26H25FN2O2S — CID 69232563
1-[(3S)-7-fluoro-1,2,3,4-tetrahydrodibenzothiophen-3-yl]-N-[[(2S)-8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl]methyl]methanamine (PubChem CID 69232563) has the molecular formula C26H25FN2O2S and a molecular weight of 448.56 g/mol. Its IUPAC name is 1-[(3S)-7-fluoro-1,2,3,4-tetrahydrodibenzothiophen-3-yl]-N-[[(2S)-8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl]methyl]methanamine.
| Compound Name | 1-[(3S)-7-fluoro-1,2,3,4-tetrahydrodibenzothiophen-3-yl]-N-[[(2S)-8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl]methyl]methanamine |
|---|---|
| PubChem CID | 69232563 |
| Molecular Formula | C26H25FN2O2S |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 1-[(3S)-7-fluoro-1,2,3,4-tetrahydrodibenzothiophen-3-yl]-N-[[(2S)-8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl]methyl]methanamine |
| SMILES | Cc1ccc2c3c(ccc2n1)OC[C@H](CNC[C@H]1CCc2c(sc4cc(F)ccc24)C1)O3 |
| InChI | InChI=1S/C26H25FN2O2S/c1-15-2-5-21-22(29-15)8-9-23-26(21)31-18(14-30-23)13-28-12-16-3-6-19-20-7-4-17(27)11-25(20)32-24(19)10-16/h2,4-5,7-9,11,16,18,28H,3,6,10,12-14H2,1H3/t16-,18-/m0/s1 |
| InChIKey | OQXGFKYOSPALBE-WMZOPIPTSA-N |
| XLogP | 5.43 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |