C25H26FN3O2 — CID 10251508
4-(5-fluoro-1H-indol-3-yl)-N-[(8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl)methyl]butan-1-amine (PubChem CID 10251508) has the molecular formula C25H26FN3O2 and a molecular weight of 419.50 g/mol. Its IUPAC name is 4-(5-fluoro-1H-indol-3-yl)-N-[(8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl)methyl]butan-1-amine.
| Compound Name | 4-(5-fluoro-1H-indol-3-yl)-N-[(8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 10251508 |
| Molecular Formula | C25H26FN3O2 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 4-(5-fluoro-1H-indol-3-yl)-N-[(8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl)methyl]butan-1-amine |
| SMILES | Cc1ccc2c3c(ccc2n1)OCC(CNCCCCc1c[nH]c2ccc(F)cc12)O3 |
| InChI | InChI=1S/C25H26FN3O2/c1-16-5-7-20-23(29-16)9-10-24-25(20)31-19(15-30-24)14-27-11-3-2-4-17-13-28-22-8-6-18(26)12-21(17)22/h5-10,12-13,19,27-28H,2-4,11,14-15H2,1H3 |
| InChIKey | SKZOUPXKXLNDCK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|