C22H26N2O4 — CID 18923868
3-[[4-(5-methoxy-1H-indol-3-yl)butylamino]methyl]-2,3-dihydro-1,4-benzodioxin-6-ol (PubChem CID 18923868) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 3-[[4-(5-methoxy-1H-indol-3-yl)butylamino]methyl]-2,3-dihydro-1,4-benzodioxin-6-ol.
| Compound Name | 3-[[4-(5-methoxy-1H-indol-3-yl)butylamino]methyl]-2,3-dihydro-1,4-benzodioxin-6-ol |
|---|---|
| PubChem CID | 18923868 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 3-[[4-(5-methoxy-1H-indol-3-yl)butylamino]methyl]-2,3-dihydro-1,4-benzodioxin-6-ol |
| SMILES | COc1ccc2[nH]cc(CCCCNCC3COc4ccc(O)cc4O3)c2c1 |
| InChI | InChI=1S/C22H26N2O4/c1-26-17-6-7-20-19(11-17)15(12-24-20)4-2-3-9-23-13-18-14-27-21-8-5-16(25)10-22(21)28-18/h5-8,10-12,18,23-25H,2-4,9,13-14H2,1H3 |
| InChIKey | LEHGFKJWCSPFEK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 75.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|