C21H24N2O3 — CID 18923893
3-[[4-(1H-indol-3-yl)butylamino]methyl]-2,3-dihydro-1,4-benzodioxin-6-ol (PubChem CID 18923893) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 3-[[4-(1H-indol-3-yl)butylamino]methyl]-2,3-dihydro-1,4-benzodioxin-6-ol.
| Compound Name | 3-[[4-(1H-indol-3-yl)butylamino]methyl]-2,3-dihydro-1,4-benzodioxin-6-ol |
|---|---|
| PubChem CID | 18923893 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 3-[[4-(1H-indol-3-yl)butylamino]methyl]-2,3-dihydro-1,4-benzodioxin-6-ol |
| SMILES | Oc1ccc2c(c1)OC(CNCCCCc1c[nH]c3ccccc13)CO2 |
| InChI | InChI=1S/C21H24N2O3/c24-16-8-9-20-21(11-16)26-17(14-25-20)13-22-10-4-3-5-15-12-23-19-7-2-1-6-18(15)19/h1-2,6-9,11-12,17,22-24H,3-5,10,13-14H2 |
| InChIKey | GAGREOKHSBLUHI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 66.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|