C30H32FN3O2 — CID 69473938
N-[(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)methyl]-N-[(8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl)methyl]cyclobutanamine (PubChem CID 69473938) has the molecular formula C30H32FN3O2 and a molecular weight of 485.60 g/mol. Its IUPAC name is N-[(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)methyl]-N-[(8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl)methyl]cyclobutanamine.
| Compound Name | N-[(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)methyl]-N-[(8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl)methyl]cyclobutanamine |
|---|---|
| PubChem CID | 69473938 |
| Molecular Formula | C30H32FN3O2 |
| Molecular Weight | 485.60 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | N-[(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)methyl]-N-[(8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl)methyl]cyclobutanamine |
| SMILES | Cc1ccc2c3c(ccc2n1)OCC(CN(CC1CCc2[nH]c4ccc(F)cc4c2C1)C1CCC1)O3 |
| InChI | InChI=1S/C30H32FN3O2/c1-18-5-8-23-26(32-18)11-12-29-30(23)36-22(17-35-29)16-34(21-3-2-4-21)15-19-6-9-27-24(13-19)25-14-20(31)7-10-28(25)33-27/h5,7-8,10-12,14,19,21-22,33H,2-4,6,9,13,15-17H2,1H3 |
| InChIKey | ZNQIGTJQBHTCOO-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.60 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|