C29H32FN3O2 — CID 91427833
8-[cyclopropylmethyl-[(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)methyl]amino]-2-methyl-1,7,8,9-tetrahydropyrano[3,2-e]isoindol-3-one (PubChem CID 91427833) has the molecular formula C29H32FN3O2 and a molecular weight of 473.59 g/mol. Its IUPAC name is 8-[cyclopropylmethyl-[(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)methyl]amino]-2-methyl-1,7,8,9-tetrahydropyrano[3,2-e]isoindol-3-one.
| Compound Name | 8-[cyclopropylmethyl-[(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)methyl]amino]-2-methyl-1,7,8,9-tetrahydropyrano[3,2-e]isoindol-3-one |
|---|---|
| PubChem CID | 91427833 |
| Molecular Formula | C29H32FN3O2 |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | 8-[cyclopropylmethyl-[(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)methyl]amino]-2-methyl-1,7,8,9-tetrahydropyrano[3,2-e]isoindol-3-one |
| SMILES | CN1Cc2c(ccc3c2CC(N(CC2CC2)CC2CCc4[nH]c5ccc(F)cc5c4C2)CO3)C1=O |
| InChI | InChI=1S/C29H32FN3O2/c1-32-15-25-21(29(32)34)6-9-28-24(25)12-20(16-35-28)33(13-17-2-3-17)14-18-4-7-26-22(10-18)23-11-19(30)5-8-27(23)31-26/h5-6,8-9,11,17-18,20,31H,2-4,7,10,12-16H2,1H3 |
| InChIKey | FCKQNTUWELTMBN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|