C27H29F2N3O2 — CID 69067992
8-[cyclopropylmethyl-[3-(5,7-difluoro-1H-indol-3-yl)propyl]amino]-2-methyl-3,7,8,9-tetrahydropyrano[2,3-g]isoindol-1-one (PubChem CID 69067992) has the molecular formula C27H29F2N3O2 and a molecular weight of 465.54 g/mol. Its IUPAC name is 8-[cyclopropylmethyl-[3-(5,7-difluoro-1H-indol-3-yl)propyl]amino]-2-methyl-3,7,8,9-tetrahydropyrano[2,3-g]isoindol-1-one.
| Compound Name | 8-[cyclopropylmethyl-[3-(5,7-difluoro-1H-indol-3-yl)propyl]amino]-2-methyl-3,7,8,9-tetrahydropyrano[2,3-g]isoindol-1-one |
|---|---|
| PubChem CID | 69067992 |
| Molecular Formula | C27H29F2N3O2 |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 8-[cyclopropylmethyl-[3-(5,7-difluoro-1H-indol-3-yl)propyl]amino]-2-methyl-3,7,8,9-tetrahydropyrano[2,3-g]isoindol-1-one |
| SMILES | CN1Cc2ccc3c(c2C1=O)CC(N(CCCc1c[nH]c2c(F)cc(F)cc12)CC1CC1)CO3 |
| InChI | InChI=1S/C27H29F2N3O2/c1-31-14-18-6-7-24-22(25(18)27(31)33)11-20(15-34-24)32(13-16-4-5-16)8-2-3-17-12-30-26-21(17)9-19(28)10-23(26)29/h6-7,9-10,12,16,20,30H,2-5,8,11,13-15H2,1H3 |
| InChIKey | LIBNOLGKMCCESH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |