C28H29FN4O2 — CID 69071210
3-[3-[cyclopropylmethyl-(6-fluoro-1-oxo-2,3,4,8,9,10-hexahydropyrano[2,3-h]isoquinolin-9-yl)amino]propyl]-1H-indole-5-carbonitrile (PubChem CID 69071210) has the molecular formula C28H29FN4O2 and a molecular weight of 472.56 g/mol. Its IUPAC name is 3-[3-[cyclopropylmethyl-(6-fluoro-1-oxo-2,3,4,8,9,10-hexahydropyrano[2,3-h]isoquinolin-9-yl)amino]propyl]-1H-indole-5-carbonitrile.
| Compound Name | 3-[3-[cyclopropylmethyl-(6-fluoro-1-oxo-2,3,4,8,9,10-hexahydropyrano[2,3-h]isoquinolin-9-yl)amino]propyl]-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 69071210 |
| Molecular Formula | C28H29FN4O2 |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 3-[3-[cyclopropylmethyl-(6-fluoro-1-oxo-2,3,4,8,9,10-hexahydropyrano[2,3-h]isoquinolin-9-yl)amino]propyl]-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]cc(CCCN(CC3CC3)C3COc4c(F)cc5c(c4C3)C(=O)NCC5)c2c1 |
| InChI | InChI=1S/C28H29FN4O2/c29-24-11-19-7-8-31-28(34)26(19)23-12-21(16-35-27(23)24)33(15-17-3-4-17)9-1-2-20-14-32-25-6-5-18(13-30)10-22(20)25/h5-6,10-11,14,17,21,32H,1-4,7-9,12,15-16H2,(H,31,34) |
| InChIKey | NEDHQABIPQEHBN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |