C23H22N4O2 — CID 46225264
3-[3-[(1-oxo-3,7,8,9-tetrahydro-2H-pyrano[3,2-e]isoindol-8-yl)amino]propyl]-1H-indole-5-carbonitrile (PubChem CID 46225264) has the molecular formula C23H22N4O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is 3-[3-[(1-oxo-3,7,8,9-tetrahydro-2H-pyrano[3,2-e]isoindol-8-yl)amino]propyl]-1H-indole-5-carbonitrile.
| Compound Name | 3-[3-[(1-oxo-3,7,8,9-tetrahydro-2H-pyrano[3,2-e]isoindol-8-yl)amino]propyl]-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 46225264 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 3-[3-[(1-oxo-3,7,8,9-tetrahydro-2H-pyrano[3,2-e]isoindol-8-yl)amino]propyl]-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]cc(CCCNC3COc4ccc5c(c4C3)C(=O)NC5)c2c1 |
| InChI | InChI=1S/C23H22N4O2/c24-10-14-3-5-20-18(8-14)15(11-26-20)2-1-7-25-17-9-19-21(29-13-17)6-4-16-12-27-23(28)22(16)19/h3-6,8,11,17,25-26H,1-2,7,9,12-13H2,(H,27,28) |
| InChIKey | RQESDRFAXQLNBU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 89.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|