C21H23N3O2 — CID 59804386
(3R)-3-[3-(1H-indol-3-yl)propylamino]-3,4-dihydro-2H-chromene-5-carboxamide (PubChem CID 59804386) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is (3R)-3-[3-(1H-indol-3-yl)propylamino]-3,4-dihydro-2H-chromene-5-carboxamide.
| Compound Name | (3R)-3-[3-(1H-indol-3-yl)propylamino]-3,4-dihydro-2H-chromene-5-carboxamide |
|---|---|
| PubChem CID | 59804386 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | (3R)-3-[3-(1H-indol-3-yl)propylamino]-3,4-dihydro-2H-chromene-5-carboxamide |
| SMILES | NC(=O)c1cccc2c1C[C@@H](NCCCc1c[nH]c3ccccc13)CO2 |
| InChI | InChI=1S/C21H23N3O2/c22-21(25)17-7-3-9-20-18(17)11-15(13-26-20)23-10-4-5-14-12-24-19-8-2-1-6-16(14)19/h1-3,6-9,12,15,23-24H,4-5,10-11,13H2,(H2,22,25)/t15-/m1/s1 |
| InChIKey | QUNHHJGFTAMACY-OAHLLOKOSA-N |
| XLogP | 2.79 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|