C21H24ClFN2O2 — CID 11845452
N-[3-(5-fluoro-1H-indol-3-yl)propyl]-5-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride (PubChem CID 11845452) has the molecular formula C21H24ClFN2O2 and a molecular weight of 390.89 g/mol. Its IUPAC name is N-[3-(5-fluoro-1H-indol-3-yl)propyl]-5-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride.
| Compound Name | N-[3-(5-fluoro-1H-indol-3-yl)propyl]-5-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride |
|---|---|
| PubChem CID | 11845452 |
| Molecular Formula | C21H24ClFN2O2 |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | N-[3-(5-fluoro-1H-indol-3-yl)propyl]-5-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride |
| SMILES | COc1cccc2c1CC(NCCCc1c[nH]c3ccc(F)cc13)CO2.Cl |
| InChI | InChI=1S/C21H23FN2O2.ClH/c1-25-20-5-2-6-21-18(20)11-16(13-26-21)23-9-3-4-14-12-24-19-8-7-15(22)10-17(14)19;/h2,5-8,10,12,16,23-24H,3-4,9,11,13H2,1H3;1H |
| InChIKey | NMTQGXPWZVNYPV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|