C21H23ClF2N2O2 — CID 25138737
8-fluoro-N-[3-(5-fluoro-1H-indol-3-yl)propyl]-5-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride (PubChem CID 25138737) has the molecular formula C21H23ClF2N2O2 and a molecular weight of 408.88 g/mol. Its IUPAC name is 8-fluoro-N-[3-(5-fluoro-1H-indol-3-yl)propyl]-5-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride.
| Compound Name | 8-fluoro-N-[3-(5-fluoro-1H-indol-3-yl)propyl]-5-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride |
|---|---|
| PubChem CID | 25138737 |
| Molecular Formula | C21H23ClF2N2O2 |
| Molecular Weight | 408.88 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 8-fluoro-N-[3-(5-fluoro-1H-indol-3-yl)propyl]-5-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride |
| SMILES | COc1ccc(F)c2c1CC(NCCCc1c[nH]c3ccc(F)cc13)CO2.Cl |
| InChI | InChI=1S/C21H22F2N2O2.ClH/c1-26-20-7-5-18(23)21-17(20)10-15(12-27-21)24-8-2-3-13-11-25-19-6-4-14(22)9-16(13)19;/h4-7,9,11,15,24-25H,2-3,8,10,12H2,1H3;1H |
| InChIKey | ZYDLCFKWCBDWRE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.88 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|