C27H29F2N3O2 — CID 91471050
N'-cyclobutyl-8-fluoro-N'-[(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)methyl]-3,4-dihydro-2H-chromene-5-carbohydrazide (PubChem CID 91471050) has the molecular formula C27H29F2N3O2 and a molecular weight of 465.54 g/mol. Its IUPAC name is N'-cyclobutyl-8-fluoro-N'-[(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)methyl]-3,4-dihydro-2H-chromene-5-carbohydrazide.
| Compound Name | N'-cyclobutyl-8-fluoro-N'-[(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)methyl]-3,4-dihydro-2H-chromene-5-carbohydrazide |
|---|---|
| PubChem CID | 91471050 |
| Molecular Formula | C27H29F2N3O2 |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | N'-cyclobutyl-8-fluoro-N'-[(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)methyl]-3,4-dihydro-2H-chromene-5-carbohydrazide |
| SMILES | O=C(NN(CC1CCc2[nH]c3ccc(F)cc3c2C1)C1CCC1)c1ccc(F)c2c1CCCO2 |
| InChI | InChI=1S/C27H29F2N3O2/c28-17-7-11-25-22(14-17)21-13-16(6-10-24(21)30-25)15-32(18-3-1-4-18)31-27(33)20-8-9-23(29)26-19(20)5-2-12-34-26/h7-9,11,14,16,18,30H,1-6,10,12-13,15H2,(H,31,33) |
| InChIKey | BNJCXOPGSYSVOC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|