C28H33ClFN3O3 — CID 69237428
1-[(3S)-6-fluoro-9-methyl-1,2,3,4-tetrahydrocarbazol-3-yl]-N-methyl-N-[[(2S)-8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl]methyl]methanamine;hydrate;hydrochloride (PubChem CID 69237428) has the molecular formula C28H33ClFN3O3 and a molecular weight of 514.04 g/mol. Its IUPAC name is 1-[(3S)-6-fluoro-9-methyl-1,2,3,4-tetrahydrocarbazol-3-yl]-N-methyl-N-[[(2S)-8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl]methyl]methanamine;hydrate;hydrochloride.
| Compound Name | 1-[(3S)-6-fluoro-9-methyl-1,2,3,4-tetrahydrocarbazol-3-yl]-N-methyl-N-[[(2S)-8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl]methyl]methanamine;hydrate;hydrochloride |
|---|---|
| PubChem CID | 69237428 |
| Molecular Formula | C28H33ClFN3O3 |
| Molecular Weight | 514.04 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | 1-[(3S)-6-fluoro-9-methyl-1,2,3,4-tetrahydrocarbazol-3-yl]-N-methyl-N-[[(2S)-8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-2-yl]methyl]methanamine;hydrate;hydrochloride |
| SMILES | Cc1ccc2c3c(ccc2n1)OC[C@H](CN(C)C[C@H]1CCc2c(c4cc(F)ccc4n2C)C1)O3.Cl.O |
| InChI | InChI=1S/C28H30FN3O2.ClH.H2O/c1-17-4-7-21-24(30-17)8-11-27-28(21)34-20(16-33-27)15-31(2)14-18-5-9-25-22(12-18)23-13-19(29)6-10-26(23)32(25)3;;/h4,6-8,10-11,13,18,20H,5,9,12,14-16H2,1-3H3;1H;1H2/t18-,20-;;/m0../s1 |
| InChIKey | RPMNTMXSIZHYIT-OINVMNEBSA-N |
| XLogP | 4.65 |
| TPSA | 71.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.04 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|