C26H31ClN2O6S — CID 3455544
3-chloro-N-[2-[2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]adamantane-1-carboxamide (PubChem CID 3455544) has the molecular formula C26H31ClN2O6S and a molecular weight of 535.06 g/mol. Its IUPAC name is 3-chloro-N-[2-[2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]adamantane-1-carboxamide.
| Compound Name | 3-chloro-N-[2-[2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 3455544 |
| Molecular Formula | C26H31ClN2O6S |
| Molecular Weight | 535.06 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | 3-chloro-N-[2-[2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]adamantane-1-carboxamide |
| SMILES | COc1cc(C=C2SC(=O)N(CCNC(=O)C34CC5CC(CC(Cl)(C5)C3)C4)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C26H31ClN2O6S/c1-33-18-7-15(8-19(34-2)21(18)35-3)9-20-22(30)29(24(32)36-20)5-4-28-23(31)25-10-16-6-17(11-25)13-26(27,12-16)14-25/h7-9,16-17H,4-6,10-14H2,1-3H3,(H,28,31) |
| InChIKey | RRYQNEWBABXAOQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.06 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|