C25H24ClN5O4S — CID 136836706
N-[2-[(5E)-5-[(2-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-[ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]acetamide (PubChem CID 136836706) has the molecular formula C25H24ClN5O4S and a molecular weight of 526.02 g/mol. Its IUPAC name is N-[2-[(5E)-5-[(2-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-[ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]acetamide.
| Compound Name | N-[2-[(5E)-5-[(2-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-[ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 136836706 |
| Molecular Formula | C25H24ClN5O4S |
| Molecular Weight | 526.02 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | N-[2-[(5E)-5-[(2-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-[ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]acetamide |
| SMILES | CCN(CC(=O)NCCN1C(=O)S/C(=C/c2ccccc2Cl)C1=O)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C25H24ClN5O4S/c1-2-30(14-21-28-19-10-6-4-8-17(19)23(33)29-21)15-22(32)27-11-12-31-24(34)20(36-25(31)35)13-16-7-3-5-9-18(16)26/h3-10,13H,2,11-12,14-15H2,1H3,(H,27,32)(H,28,29,33)/b20-13+ |
| InChIKey | UASMRHMWUGVCTC-DEDYPNTBSA-N |
| XLogP | 3.25 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.02 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|