C24H23Cl2N3O5S2 — CID 4858650
2-chloro-N-[2-[5-[(2-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-5-piperidin-1-ylsulfonylbenzamide (PubChem CID 4858650) has the molecular formula C24H23Cl2N3O5S2 and a molecular weight of 568.50 g/mol. Its IUPAC name is 2-chloro-N-[2-[5-[(2-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-5-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 2-chloro-N-[2-[5-[(2-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-5-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 4858650 |
| Molecular Formula | C24H23Cl2N3O5S2 |
| Molecular Weight | 568.50 g/mol |
| Exact Mass | 567.05 |
| IUPAC Name | 2-chloro-N-[2-[5-[(2-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-5-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NCCN1C(=O)SC(=Cc2ccccc2Cl)C1=O)c1cc(S(=O)(=O)N2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C24H23Cl2N3O5S2/c25-19-7-3-2-6-16(19)14-21-23(31)29(24(32)35-21)13-10-27-22(30)18-15-17(8-9-20(18)26)36(33,34)28-11-4-1-5-12-28/h2-3,6-9,14-15H,1,4-5,10-13H2,(H,27,30) |
| InChIKey | LWLSRPFAIBVLGU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|