C26H22N2O4S — CID 17111332
N-[2-methoxy-4-[(3-phenylmethoxybenzoyl)amino]phenyl]thiophene-2-carboxamide (PubChem CID 17111332) has the molecular formula C26H22N2O4S and a molecular weight of 458.54 g/mol. Its IUPAC name is N-[2-methoxy-4-[(3-phenylmethoxybenzoyl)amino]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[2-methoxy-4-[(3-phenylmethoxybenzoyl)amino]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 17111332 |
| Molecular Formula | C26H22N2O4S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | N-[2-methoxy-4-[(3-phenylmethoxybenzoyl)amino]phenyl]thiophene-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2cccc(OCc3ccccc3)c2)ccc1NC(=O)c1cccs1 |
| InChI | InChI=1S/C26H22N2O4S/c1-31-23-16-20(12-13-22(23)28-26(30)24-11-6-14-33-24)27-25(29)19-9-5-10-21(15-19)32-17-18-7-3-2-4-8-18/h2-16H,17H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | DHWPHHUPVBRORR-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |