C25H27N3O4 — CID 4105259
3,4,5-triethoxy-N-[[phenyl(pyridin-4-yl)methylidene]amino]benzamide (PubChem CID 4105259) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[[phenyl(pyridin-4-yl)methylidene]amino]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[[phenyl(pyridin-4-yl)methylidene]amino]benzamide |
|---|---|
| PubChem CID | 4105259 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 3,4,5-triethoxy-N-[[phenyl(pyridin-4-yl)methylidene]amino]benzamide |
| SMILES | CCOc1cc(C(=O)NN=C(c2ccccc2)c2ccncc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C25H27N3O4/c1-4-30-21-16-20(17-22(31-5-2)24(21)32-6-3)25(29)28-27-23(18-10-8-7-9-11-18)19-12-14-26-15-13-19/h7-17H,4-6H2,1-3H3,(H,28,29) |
| InChIKey | QZFJFDSQWQGVED-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|