C23H30N2O4 — CID 4109578
3,4,5-triethoxy-N-[1-(4-methylphenyl)propylideneamino]benzamide (PubChem CID 4109578) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[1-(4-methylphenyl)propylideneamino]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[1-(4-methylphenyl)propylideneamino]benzamide |
|---|---|
| PubChem CID | 4109578 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 3,4,5-triethoxy-N-[1-(4-methylphenyl)propylideneamino]benzamide |
| SMILES | CCOc1cc(C(=O)NN=C(CC)c2ccc(C)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H30N2O4/c1-6-19(17-12-10-16(5)11-13-17)24-25-23(26)18-14-20(27-7-2)22(29-9-4)21(15-18)28-8-3/h10-15H,6-9H2,1-5H3,(H,25,26) |
| InChIKey | JLMWMSRFNIVLAL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|