C23H30N2O4 — CID 4930636
N-[1-(2,4-dimethoxyphenyl)ethylideneamino]-4-hexoxybenzamide (PubChem CID 4930636) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is N-[1-(2,4-dimethoxyphenyl)ethylideneamino]-4-hexoxybenzamide.
| Compound Name | N-[1-(2,4-dimethoxyphenyl)ethylideneamino]-4-hexoxybenzamide |
|---|---|
| PubChem CID | 4930636 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | N-[1-(2,4-dimethoxyphenyl)ethylideneamino]-4-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(C(=O)NN=C(C)c2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C23H30N2O4/c1-5-6-7-8-15-29-19-11-9-18(10-12-19)23(26)25-24-17(2)21-14-13-20(27-3)16-22(21)28-4/h9-14,16H,5-8,15H2,1-4H3,(H,25,26) |
| InChIKey | IYULVSAVUAHYBL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|