C19H21N3O7 — CID 163326318
4-amino-N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]benzamide;oxalic acid (PubChem CID 163326318) has the molecular formula C19H21N3O7 and a molecular weight of 403.39 g/mol. Its IUPAC name is 4-amino-N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]benzamide;oxalic acid.
| Compound Name | 4-amino-N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]benzamide;oxalic acid |
|---|---|
| PubChem CID | 163326318 |
| Molecular Formula | C19H21N3O7 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 4-amino-N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]benzamide;oxalic acid |
| SMILES | COc1ccc(/C(C)=N\NC(=O)c2ccc(N)cc2)c(OC)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H19N3O3.C2H2O4/c1-11(15-9-8-14(22-2)10-16(15)23-3)19-20-17(21)12-4-6-13(18)7-5-12;3-1(4)2(5)6/h4-10H,18H2,1-3H3,(H,20,21);(H,3,4)(H,5,6)/b19-11-; |
| InChIKey | AUFHIUPYVYPPDP-XHFAFUTOSA-N |
| XLogP | 1.60 |
| TPSA | 160.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|