C19H19IN2O7 — CID 171151393
N-[1-(2,4-dimethoxyphenyl)ethylideneamino]-3-iodobenzamide;oxalic acid (PubChem CID 171151393) has the molecular formula C19H19IN2O7 and a molecular weight of 514.27 g/mol. Its IUPAC name is N-[1-(2,4-dimethoxyphenyl)ethylideneamino]-3-iodobenzamide;oxalic acid.
| Compound Name | N-[1-(2,4-dimethoxyphenyl)ethylideneamino]-3-iodobenzamide;oxalic acid |
|---|---|
| PubChem CID | 171151393 |
| Molecular Formula | C19H19IN2O7 |
| Molecular Weight | 514.27 g/mol |
| Exact Mass | 514.02 |
| IUPAC Name | N-[1-(2,4-dimethoxyphenyl)ethylideneamino]-3-iodobenzamide;oxalic acid |
| SMILES | COc1ccc(C(C)=NNC(=O)c2cccc(I)c2)c(OC)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H17IN2O3.C2H2O4/c1-11(15-8-7-14(22-2)10-16(15)23-3)19-20-17(21)12-5-4-6-13(18)9-12;3-1(4)2(5)6/h4-10H,1-3H3,(H,20,21);(H,3,4)(H,5,6) |
| InChIKey | GBFOETITPKIMES-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 134.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|