C27H34ClF3N4O2 — CID 126711173
2-chloro-N-[3-[[(1-pentan-2-ylpiperidin-4-yl)-[[3-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]phenyl]acetamide (PubChem CID 126711173) has the molecular formula C27H34ClF3N4O2 and a molecular weight of 539.04 g/mol. Its IUPAC name is 2-chloro-N-[3-[[(1-pentan-2-ylpiperidin-4-yl)-[[3-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]phenyl]acetamide.
| Compound Name | 2-chloro-N-[3-[[(1-pentan-2-ylpiperidin-4-yl)-[[3-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 126711173 |
| Molecular Formula | C27H34ClF3N4O2 |
| Molecular Weight | 539.04 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | 2-chloro-N-[3-[[(1-pentan-2-ylpiperidin-4-yl)-[[3-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]phenyl]acetamide |
| SMILES | CCCC(C)N1CCC(N(Cc2cccc(NC(=O)CCl)c2)C(=O)Nc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C27H34ClF3N4O2/c1-3-6-19(2)34-13-11-24(12-14-34)35(18-20-7-4-9-22(15-20)32-25(36)17-28)26(37)33-23-10-5-8-21(16-23)27(29,30)31/h4-5,7-10,15-16,19,24H,3,6,11-14,17-18H2,1-2H3,(H,32,36)(H,33,37) |
| InChIKey | WFYZKBRFXJYIIF-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.04 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|