C24H31Cl2N3O2 — CID 126711390
1-benzyl-3-(3,5-dichloro-4-hydroxyphenyl)-1-(1-pentan-2-ylpiperidin-4-yl)urea (PubChem CID 126711390) has the molecular formula C24H31Cl2N3O2 and a molecular weight of 464.44 g/mol. Its IUPAC name is 1-benzyl-3-(3,5-dichloro-4-hydroxyphenyl)-1-(1-pentan-2-ylpiperidin-4-yl)urea.
| Compound Name | 1-benzyl-3-(3,5-dichloro-4-hydroxyphenyl)-1-(1-pentan-2-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 126711390 |
| Molecular Formula | C24H31Cl2N3O2 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 1-benzyl-3-(3,5-dichloro-4-hydroxyphenyl)-1-(1-pentan-2-ylpiperidin-4-yl)urea |
| SMILES | CCCC(C)N1CCC(N(Cc2ccccc2)C(=O)Nc2cc(Cl)c(O)c(Cl)c2)CC1 |
| InChI | InChI=1S/C24H31Cl2N3O2/c1-3-7-17(2)28-12-10-20(11-13-28)29(16-18-8-5-4-6-9-18)24(31)27-19-14-21(25)23(30)22(26)15-19/h4-6,8-9,14-15,17,20,30H,3,7,10-13,16H2,1-2H3,(H,27,31) |
| InChIKey | UAFMMOPGQGSQIL-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|