C26H37N3O — CID 126711695
1-benzyl-3-(3,5-dimethylphenyl)-1-(1-pentan-2-ylpiperidin-4-yl)urea (PubChem CID 126711695) has the molecular formula C26H37N3O and a molecular weight of 407.60 g/mol. Its IUPAC name is 1-benzyl-3-(3,5-dimethylphenyl)-1-(1-pentan-2-ylpiperidin-4-yl)urea.
| Compound Name | 1-benzyl-3-(3,5-dimethylphenyl)-1-(1-pentan-2-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 126711695 |
| Molecular Formula | C26H37N3O |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.29 |
| IUPAC Name | 1-benzyl-3-(3,5-dimethylphenyl)-1-(1-pentan-2-ylpiperidin-4-yl)urea |
| SMILES | CCCC(C)N1CCC(N(Cc2ccccc2)C(=O)Nc2cc(C)cc(C)c2)CC1 |
| InChI | InChI=1S/C26H37N3O/c1-5-9-22(4)28-14-12-25(13-15-28)29(19-23-10-7-6-8-11-23)26(30)27-24-17-20(2)16-21(3)18-24/h6-8,10-11,16-18,22,25H,5,9,12-15,19H2,1-4H3,(H,27,30) |
| InChIKey | GYANJAMLYIJTLT-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |