C25H34FN3O — CID 126711638
1-benzyl-3-(2-fluoro-4-methylphenyl)-1-(1-pentan-2-ylpiperidin-4-yl)urea (PubChem CID 126711638) has the molecular formula C25H34FN3O and a molecular weight of 411.57 g/mol. Its IUPAC name is 1-benzyl-3-(2-fluoro-4-methylphenyl)-1-(1-pentan-2-ylpiperidin-4-yl)urea.
| Compound Name | 1-benzyl-3-(2-fluoro-4-methylphenyl)-1-(1-pentan-2-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 126711638 |
| Molecular Formula | C25H34FN3O |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.27 |
| IUPAC Name | 1-benzyl-3-(2-fluoro-4-methylphenyl)-1-(1-pentan-2-ylpiperidin-4-yl)urea |
| SMILES | CCCC(C)N1CCC(N(Cc2ccccc2)C(=O)Nc2ccc(C)cc2F)CC1 |
| InChI | InChI=1S/C25H34FN3O/c1-4-8-20(3)28-15-13-22(14-16-28)29(18-21-9-6-5-7-10-21)25(30)27-24-12-11-19(2)17-23(24)26/h5-7,9-12,17,20,22H,4,8,13-16,18H2,1-3H3,(H,27,30) |
| InChIKey | XCWRGQZORHLKGO-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |