C29H43N3O3 — CID 145278452
ethane;methyl 4-[[benzyl-(1-pentan-2-ylpiperidin-4-yl)carbamoyl]amino]-3-methylbenzoate (PubChem CID 145278452) has the molecular formula C29H43N3O3 and a molecular weight of 481.68 g/mol. Its IUPAC name is ethane;methyl 4-[[benzyl-(1-pentan-2-ylpiperidin-4-yl)carbamoyl]amino]-3-methylbenzoate.
| Compound Name | ethane;methyl 4-[[benzyl-(1-pentan-2-ylpiperidin-4-yl)carbamoyl]amino]-3-methylbenzoate |
|---|---|
| PubChem CID | 145278452 |
| Molecular Formula | C29H43N3O3 |
| Molecular Weight | 481.68 g/mol |
| Exact Mass | 481.33 |
| IUPAC Name | ethane;methyl 4-[[benzyl-(1-pentan-2-ylpiperidin-4-yl)carbamoyl]amino]-3-methylbenzoate |
| SMILES | CC.CCCC(C)N1CCC(N(Cc2ccccc2)C(=O)Nc2ccc(C(=O)OC)cc2C)CC1 |
| InChI | InChI=1S/C27H37N3O3.C2H6/c1-5-9-21(3)29-16-14-24(15-17-29)30(19-22-10-7-6-8-11-22)27(32)28-25-13-12-23(18-20(25)2)26(31)33-4;1-2/h6-8,10-13,18,21,24H,5,9,14-17,19H2,1-4H3,(H,28,32);1-2H3 |
| InChIKey | LRLOOCLCXJDHSL-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.68 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |