C29H36N4O2 — CID 126711747
1-benzyl-1-(1-pentan-2-ylpiperidin-4-yl)-3-(3-pyridin-4-yloxyphenyl)urea (PubChem CID 126711747) has the molecular formula C29H36N4O2 and a molecular weight of 472.63 g/mol. Its IUPAC name is 1-benzyl-1-(1-pentan-2-ylpiperidin-4-yl)-3-(3-pyridin-4-yloxyphenyl)urea.
| Compound Name | 1-benzyl-1-(1-pentan-2-ylpiperidin-4-yl)-3-(3-pyridin-4-yloxyphenyl)urea |
|---|---|
| PubChem CID | 126711747 |
| Molecular Formula | C29H36N4O2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | 1-benzyl-1-(1-pentan-2-ylpiperidin-4-yl)-3-(3-pyridin-4-yloxyphenyl)urea |
| SMILES | CCCC(C)N1CCC(N(Cc2ccccc2)C(=O)Nc2cccc(Oc3ccncc3)c2)CC1 |
| InChI | InChI=1S/C29H36N4O2/c1-3-8-23(2)32-19-15-26(16-20-32)33(22-24-9-5-4-6-10-24)29(34)31-25-11-7-12-28(21-25)35-27-13-17-30-18-14-27/h4-7,9-14,17-18,21,23,26H,3,8,15-16,19-20,22H2,1-2H3,(H,31,34) |
| InChIKey | KOPIYXWKKBLANJ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |