C23H35F3N4OS — CID 145278502
1-[3-(ethenylsulfanylamino)propyl]-1-(1-pentan-2-ylpiperidin-4-yl)-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 145278502) has the molecular formula C23H35F3N4OS and a molecular weight of 472.62 g/mol. Its IUPAC name is 1-[3-(ethenylsulfanylamino)propyl]-1-(1-pentan-2-ylpiperidin-4-yl)-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-(ethenylsulfanylamino)propyl]-1-(1-pentan-2-ylpiperidin-4-yl)-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 145278502 |
| Molecular Formula | C23H35F3N4OS |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 1-[3-(ethenylsulfanylamino)propyl]-1-(1-pentan-2-ylpiperidin-4-yl)-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | C=CSNCCCN(C(=O)Nc1cccc(C(F)(F)F)c1)C1CCN(C(C)CCC)CC1 |
| InChI | InChI=1S/C23H35F3N4OS/c1-4-8-18(3)29-15-11-21(12-16-29)30(14-7-13-27-32-5-2)22(31)28-20-10-6-9-19(17-20)23(24,25)26/h5-6,9-10,17-18,21,27H,2,4,7-8,11-16H2,1,3H3,(H,28,31) |
| InChIKey | IXRXNILLAGZWQS-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|