C40H52N2O2 — CID 143006051
3-hex-1-ynyl-N-[[4-(4-methoxyphenyl)phenyl]methyl]-N-[1-(3-methylbutyl)piperidin-4-yl]benzamide;prop-1-ene (PubChem CID 143006051) has the molecular formula C40H52N2O2 and a molecular weight of 592.87 g/mol. Its IUPAC name is 3-hex-1-ynyl-N-[[4-(4-methoxyphenyl)phenyl]methyl]-N-[1-(3-methylbutyl)piperidin-4-yl]benzamide;prop-1-ene.
| Compound Name | 3-hex-1-ynyl-N-[[4-(4-methoxyphenyl)phenyl]methyl]-N-[1-(3-methylbutyl)piperidin-4-yl]benzamide;prop-1-ene |
|---|---|
| PubChem CID | 143006051 |
| Molecular Formula | C40H52N2O2 |
| Molecular Weight | 592.87 g/mol |
| Exact Mass | 592.40 |
| IUPAC Name | 3-hex-1-ynyl-N-[[4-(4-methoxyphenyl)phenyl]methyl]-N-[1-(3-methylbutyl)piperidin-4-yl]benzamide;prop-1-ene |
| SMILES | C=CC.CCCCC#Cc1cccc(C(=O)N(Cc2ccc(-c3ccc(OC)cc3)cc2)C2CCN(CCC(C)C)CC2)c1 |
| InChI | InChI=1S/C37H46N2O2.C3H6/c1-5-6-7-8-10-30-11-9-12-34(27-30)37(40)39(35-22-25-38(26-23-35)24-21-29(2)3)28-31-13-15-32(16-14-31)33-17-19-36(41-4)20-18-33;1-3-2/h9,11-20,27,29,35H,5-7,21-26,28H2,1-4H3;3H,1H2,2H3 |
| InChIKey | NZJBMGHRKMSAFM-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.87 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|