C38H51N3O3 — CID 11714122
2-ethoxy-N-[4-[[[1-(3-methylbutyl)piperidin-4-yl]-(4-pentylbenzoyl)amino]methyl]phenyl]benzamide (PubChem CID 11714122) has the molecular formula C38H51N3O3 and a molecular weight of 597.84 g/mol. Its IUPAC name is 2-ethoxy-N-[4-[[[1-(3-methylbutyl)piperidin-4-yl]-(4-pentylbenzoyl)amino]methyl]phenyl]benzamide.
| Compound Name | 2-ethoxy-N-[4-[[[1-(3-methylbutyl)piperidin-4-yl]-(4-pentylbenzoyl)amino]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 11714122 |
| Molecular Formula | C38H51N3O3 |
| Molecular Weight | 597.84 g/mol |
| Exact Mass | 597.39 |
| IUPAC Name | 2-ethoxy-N-[4-[[[1-(3-methylbutyl)piperidin-4-yl]-(4-pentylbenzoyl)amino]methyl]phenyl]benzamide |
| SMILES | CCCCCc1ccc(C(=O)N(Cc2ccc(NC(=O)c3ccccc3OCC)cc2)C2CCN(CCC(C)C)CC2)cc1 |
| InChI | InChI=1S/C38H51N3O3/c1-5-7-8-11-30-14-18-32(19-15-30)38(43)41(34-23-26-40(27-24-34)25-22-29(3)4)28-31-16-20-33(21-17-31)39-37(42)35-12-9-10-13-36(35)44-6-2/h9-10,12-21,29,34H,5-8,11,22-28H2,1-4H3,(H,39,42) |
| InChIKey | DUKWQSLOVXVHLL-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.84 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|