C36H47N3O4 — CID 70326607
3,4-dihydroxy-N-[4-[[[1-(3-methylbutyl)piperidin-4-yl]-(4-pentylbenzoyl)amino]methyl]phenyl]benzamide (PubChem CID 70326607) has the molecular formula C36H47N3O4 and a molecular weight of 585.79 g/mol. Its IUPAC name is 3,4-dihydroxy-N-[4-[[[1-(3-methylbutyl)piperidin-4-yl]-(4-pentylbenzoyl)amino]methyl]phenyl]benzamide.
| Compound Name | 3,4-dihydroxy-N-[4-[[[1-(3-methylbutyl)piperidin-4-yl]-(4-pentylbenzoyl)amino]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 70326607 |
| Molecular Formula | C36H47N3O4 |
| Molecular Weight | 585.79 g/mol |
| Exact Mass | 585.36 |
| IUPAC Name | 3,4-dihydroxy-N-[4-[[[1-(3-methylbutyl)piperidin-4-yl]-(4-pentylbenzoyl)amino]methyl]phenyl]benzamide |
| SMILES | CCCCCc1ccc(C(=O)N(Cc2ccc(NC(=O)c3ccc(O)c(O)c3)cc2)C2CCN(CCC(C)C)CC2)cc1 |
| InChI | InChI=1S/C36H47N3O4/c1-4-5-6-7-27-8-12-29(13-9-27)36(43)39(32-19-22-38(23-20-32)21-18-26(2)3)25-28-10-15-31(16-11-28)37-35(42)30-14-17-33(40)34(41)24-30/h8-17,24,26,32,40-41H,4-7,18-23,25H2,1-3H3,(H,37,42) |
| InChIKey | PYJVAOGRPZWMAJ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.79 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|