C34H44N4O2 — CID 11295672
N-[(4-morpholin-4-ylphenyl)methyl]-4-pentyl-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]benzamide (PubChem CID 11295672) has the molecular formula C34H44N4O2 and a molecular weight of 540.75 g/mol. Its IUPAC name is N-[(4-morpholin-4-ylphenyl)methyl]-4-pentyl-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]benzamide.
| Compound Name | N-[(4-morpholin-4-ylphenyl)methyl]-4-pentyl-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 11295672 |
| Molecular Formula | C34H44N4O2 |
| Molecular Weight | 540.75 g/mol |
| Exact Mass | 540.35 |
| IUPAC Name | N-[(4-morpholin-4-ylphenyl)methyl]-4-pentyl-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]benzamide |
| SMILES | CCCCCc1ccc(C(=O)N(Cc2ccc(N3CCOCC3)cc2)C2CCN(Cc3ccccn3)CC2)cc1 |
| InChI | InChI=1S/C34H44N4O2/c1-2-3-4-7-28-9-13-30(14-10-28)34(39)38(26-29-11-15-32(16-12-29)37-22-24-40-25-23-37)33-17-20-36(21-18-33)27-31-8-5-6-19-35-31/h5-6,8-16,19,33H,2-4,7,17-18,20-27H2,1H3 |
| InChIKey | QWQSZIMMAIBSIZ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.75 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|