C35H40N2OS — CID 10230477
N-(1-benzylpiperidin-4-yl)-4-pentyl-N-[(4-thiophen-2-ylphenyl)methyl]benzamide (PubChem CID 10230477) has the molecular formula C35H40N2OS and a molecular weight of 536.79 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-4-pentyl-N-[(4-thiophen-2-ylphenyl)methyl]benzamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-4-pentyl-N-[(4-thiophen-2-ylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 10230477 |
| Molecular Formula | C35H40N2OS |
| Molecular Weight | 536.79 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-4-pentyl-N-[(4-thiophen-2-ylphenyl)methyl]benzamide |
| SMILES | CCCCCc1ccc(C(=O)N(Cc2ccc(-c3cccs3)cc2)C2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C35H40N2OS/c1-2-3-5-9-28-13-19-32(20-14-28)35(38)37(27-30-15-17-31(18-16-30)34-12-8-25-39-34)33-21-23-36(24-22-33)26-29-10-6-4-7-11-29/h4,6-8,10-20,25,33H,2-3,5,9,21-24,26-27H2,1H3 |
| InChIKey | MNDOUGOWLXKPHW-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.79 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|