C39H46N2O3 — CID 10188703
N-(1-benzylpiperidin-4-yl)-N-[(1S)-2-hydroxy-1-(4-phenylmethoxyphenyl)ethyl]-4-pentylbenzamide (PubChem CID 10188703) has the molecular formula C39H46N2O3 and a molecular weight of 590.81 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-N-[(1S)-2-hydroxy-1-(4-phenylmethoxyphenyl)ethyl]-4-pentylbenzamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-N-[(1S)-2-hydroxy-1-(4-phenylmethoxyphenyl)ethyl]-4-pentylbenzamide |
|---|---|
| PubChem CID | 10188703 |
| Molecular Formula | C39H46N2O3 |
| Molecular Weight | 590.81 g/mol |
| Exact Mass | 590.35 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-N-[(1S)-2-hydroxy-1-(4-phenylmethoxyphenyl)ethyl]-4-pentylbenzamide |
| SMILES | CCCCCc1ccc(C(=O)N(C2CCN(Cc3ccccc3)CC2)[C@H](CO)c2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C39H46N2O3/c1-2-3-6-11-31-16-18-35(19-17-31)39(43)41(36-24-26-40(27-25-36)28-32-12-7-4-8-13-32)38(29-42)34-20-22-37(23-21-34)44-30-33-14-9-5-10-15-33/h4-5,7-10,12-23,36,38,42H,2-3,6,11,24-30H2,1H3/t38-/m1/s1 |
| InChIKey | DPOLVFBMXAHZEW-KXQOOQHDSA-N |
| XLogP | 7.84 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.81 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|