C43H52F2N2O2 — CID 10009626
N-[2-(3,5-difluorophenyl)-1-[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]ethyl]-4-pentyl-N-(4-phenylbutyl)benzamide (PubChem CID 10009626) has the molecular formula C43H52F2N2O2 and a molecular weight of 666.90 g/mol. Its IUPAC name is N-[2-(3,5-difluorophenyl)-1-[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]ethyl]-4-pentyl-N-(4-phenylbutyl)benzamide.
| Compound Name | N-[2-(3,5-difluorophenyl)-1-[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]ethyl]-4-pentyl-N-(4-phenylbutyl)benzamide |
|---|---|
| PubChem CID | 10009626 |
| Molecular Formula | C43H52F2N2O2 |
| Molecular Weight | 666.90 g/mol |
| Exact Mass | 666.40 |
| IUPAC Name | N-[2-(3,5-difluorophenyl)-1-[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]ethyl]-4-pentyl-N-(4-phenylbutyl)benzamide |
| SMILES | CCCCCc1ccc(C(=O)N(CCCCc2ccccc2)C(Cc2cc(F)cc(F)c2)C2CCN(Cc3ccc(OC)cc3)CC2)cc1 |
| InChI | InChI=1S/C43H52F2N2O2/c1-3-4-6-11-34-15-19-38(20-16-34)43(48)47(25-10-9-14-33-12-7-5-8-13-33)42(30-36-28-39(44)31-40(45)29-36)37-23-26-46(27-24-37)32-35-17-21-41(49-2)22-18-35/h5,7-8,12-13,15-22,28-29,31,37,42H,3-4,6,9-11,14,23-27,30,32H2,1-2H3 |
| InChIKey | YITCJTKIWAXYHH-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.90 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|