C40H54N2O2S — CID 11764567
S-phenyl N-[2-cyclohexyl-1-[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]ethyl]-N-[(4-pentylphenyl)methyl]carbamothioate (PubChem CID 11764567) has the molecular formula C40H54N2O2S and a molecular weight of 626.95 g/mol. Its IUPAC name is S-phenyl N-[2-cyclohexyl-1-[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]ethyl]-N-[(4-pentylphenyl)methyl]carbamothioate.
| Compound Name | S-phenyl N-[2-cyclohexyl-1-[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]ethyl]-N-[(4-pentylphenyl)methyl]carbamothioate |
|---|---|
| PubChem CID | 11764567 |
| Molecular Formula | C40H54N2O2S |
| Molecular Weight | 626.95 g/mol |
| Exact Mass | 626.39 |
| IUPAC Name | S-phenyl N-[2-cyclohexyl-1-[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]ethyl]-N-[(4-pentylphenyl)methyl]carbamothioate |
| SMILES | CCCCCc1ccc(CN(C(=O)Sc2ccccc2)C(CC2CCCCC2)C2CCN(Cc3ccc(OC)cc3)CC2)cc1 |
| InChI | InChI=1S/C40H54N2O2S/c1-3-4-7-12-32-17-19-35(20-18-32)31-42(40(43)45-38-15-10-6-11-16-38)39(29-33-13-8-5-9-14-33)36-25-27-41(28-26-36)30-34-21-23-37(44-2)24-22-34/h6,10-11,15-24,33,36,39H,3-5,7-9,12-14,25-31H2,1-2H3 |
| InChIKey | XGIWKWYGNBQOCA-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.95 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|