C37H52N2O2 — CID 70022493
N-[5-(2-aminoethyl)nonan-5-yl]-4-pentyl-N-[(4-phenylmethoxyphenyl)methyl]benzamide (PubChem CID 70022493) has the molecular formula C37H52N2O2 and a molecular weight of 556.84 g/mol. Its IUPAC name is N-[5-(2-aminoethyl)nonan-5-yl]-4-pentyl-N-[(4-phenylmethoxyphenyl)methyl]benzamide.
| Compound Name | N-[5-(2-aminoethyl)nonan-5-yl]-4-pentyl-N-[(4-phenylmethoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 70022493 |
| Molecular Formula | C37H52N2O2 |
| Molecular Weight | 556.84 g/mol |
| Exact Mass | 556.40 |
| IUPAC Name | N-[5-(2-aminoethyl)nonan-5-yl]-4-pentyl-N-[(4-phenylmethoxyphenyl)methyl]benzamide |
| SMILES | CCCCCc1ccc(C(=O)N(Cc2ccc(OCc3ccccc3)cc2)C(CCN)(CCCC)CCCC)cc1 |
| InChI | InChI=1S/C37H52N2O2/c1-4-7-11-14-31-17-21-34(22-18-31)36(40)39(37(27-28-38,25-8-5-2)26-9-6-3)29-32-19-23-35(24-20-32)41-30-33-15-12-10-13-16-33/h10,12-13,15-24H,4-9,11,14,25-30,38H2,1-3H3 |
| InChIKey | ABJCNGIMZGMQDN-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.84 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|