C36H47N3O2S — CID 59688900
N-(1-ethylpiperidin-4-yl)-5-pentyl-N-[[4-[4-(piperidine-1-carbonyl)phenyl]phenyl]methyl]thiophene-2-carboxamide (PubChem CID 59688900) has the molecular formula C36H47N3O2S and a molecular weight of 585.86 g/mol. Its IUPAC name is N-(1-ethylpiperidin-4-yl)-5-pentyl-N-[[4-[4-(piperidine-1-carbonyl)phenyl]phenyl]methyl]thiophene-2-carboxamide.
| Compound Name | N-(1-ethylpiperidin-4-yl)-5-pentyl-N-[[4-[4-(piperidine-1-carbonyl)phenyl]phenyl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 59688900 |
| Molecular Formula | C36H47N3O2S |
| Molecular Weight | 585.86 g/mol |
| Exact Mass | 585.34 |
| IUPAC Name | N-(1-ethylpiperidin-4-yl)-5-pentyl-N-[[4-[4-(piperidine-1-carbonyl)phenyl]phenyl]methyl]thiophene-2-carboxamide |
| SMILES | CCCCCc1ccc(C(=O)N(Cc2ccc(-c3ccc(C(=O)N4CCCCC4)cc3)cc2)C2CCN(CC)CC2)s1 |
| InChI | InChI=1S/C36H47N3O2S/c1-3-5-7-10-33-19-20-34(42-33)36(41)39(32-21-25-37(4-2)26-22-32)27-28-11-13-29(14-12-28)30-15-17-31(18-16-30)35(40)38-23-8-6-9-24-38/h11-20,32H,3-10,21-27H2,1-2H3 |
| InChIKey | UWMCNJMYESKBHC-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.86 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|