C21H19NO5 — CID 102228281
1-O-benzyl 3-O-methyl 5-benzyl-4-hydroxypyrrole-1,3-dicarboxylate (PubChem CID 102228281) has the molecular formula C21H19NO5 and a molecular weight of 365.39 g/mol. Its IUPAC name is 1-O-benzyl 3-O-methyl 5-benzyl-4-hydroxypyrrole-1,3-dicarboxylate.
| Compound Name | 1-O-benzyl 3-O-methyl 5-benzyl-4-hydroxypyrrole-1,3-dicarboxylate |
|---|---|
| PubChem CID | 102228281 |
| Molecular Formula | C21H19NO5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 1-O-benzyl 3-O-methyl 5-benzyl-4-hydroxypyrrole-1,3-dicarboxylate |
| SMILES | COC(=O)c1cn(C(=O)OCc2ccccc2)c(Cc2ccccc2)c1O |
| InChI | InChI=1S/C21H19NO5/c1-26-20(24)17-13-22(21(25)27-14-16-10-6-3-7-11-16)18(19(17)23)12-15-8-4-2-5-9-15/h2-11,13,23H,12,14H2,1H3 |
| InChIKey | UZXUIRKJNLLGGZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |